C8H11NO4 — CID 91982415
[(E)-3-(2-oxo-1,3-oxazolidin-4-yl)prop-2-enyl] acetate (PubChem CID 91982415) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is [(E)-3-(2-oxo-1,3-oxazolidin-4-yl)prop-2-enyl] acetate.
| Compound Name | [(E)-3-(2-oxo-1,3-oxazolidin-4-yl)prop-2-enyl] acetate |
|---|---|
| PubChem CID | 91982415 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | [(E)-3-(2-oxo-1,3-oxazolidin-4-yl)prop-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C/C1COC(=O)N1 |
| InChI | InChI=1S/C8H11NO4/c1-6(10)12-4-2-3-7-5-13-8(11)9-7/h2-3,7H,4-5H2,1H3,(H,9,11)/b3-2+ |
| InChIKey | ASOAEZPKUIZSML-NSCUHMNNSA-N |
| XLogP | 0.21 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|