C16H24O3 — CID 10706752
(1R,4R)-2,3,5-tris(methoxymethyl)-7-propan-2-ylidenebicyclo[2.2.1]hepta-2,5-diene (PubChem CID 10706752) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (1R,4R)-2,3,5-tris(methoxymethyl)-7-propan-2-ylidenebicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | (1R,4R)-2,3,5-tris(methoxymethyl)-7-propan-2-ylidenebicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 10706752 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (1R,4R)-2,3,5-tris(methoxymethyl)-7-propan-2-ylidenebicyclo[2.2.1]hepta-2,5-diene |
| SMILES | COCC1=C[C@H]2C(COC)=C(COC)[C@@H]1C2=C(C)C |
| InChI | InChI=1S/C16H24O3/c1-10(2)15-12-6-11(7-17-3)16(15)14(9-19-5)13(12)8-18-4/h6,12,16H,7-9H2,1-5H3/t12-,16+/m0/s1 |
| InChIKey | KDRZUQVDGAOUEP-BLLLJJGKSA-N |
| XLogP | 2.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|