C15H12CrO6 — CID 13379864
carbon monoxide;[methoxy-(3-methyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylidene]chromium (PubChem CID 13379864) has the molecular formula C15H12CrO6 and a molecular weight of 340.25 g/mol. Its IUPAC name is carbon monoxide;[methoxy-(3-methyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylidene]chromium.
| Compound Name | carbon monoxide;[methoxy-(3-methyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylidene]chromium |
|---|---|
| PubChem CID | 13379864 |
| Molecular Formula | C15H12CrO6 |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | carbon monoxide;[methoxy-(3-methyl-2-bicyclo[2.2.1]hepta-2,5-dienyl)methylidene]chromium |
| SMILES | COC(=[Cr])C1=C(C)C2C=CC1C2.[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+] |
| InChI | InChI=1S/C10H12O.5CO.Cr/c1-7-8-3-4-9(5-8)10(7)6-11-2;5*1-2;/h3-4,8-9H,5H2,1-2H3;;;;;; |
| InChIKey | JDLLIOHGRYUNBV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 108.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|