C18H20O2 — CID 10707027
1,4-dimethoxy-2-methyl-5-[(E)-2-phenylprop-1-enyl]benzene (PubChem CID 10707027) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1,4-dimethoxy-2-methyl-5-[(E)-2-phenylprop-1-enyl]benzene.
| Compound Name | 1,4-dimethoxy-2-methyl-5-[(E)-2-phenylprop-1-enyl]benzene |
|---|---|
| PubChem CID | 10707027 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1,4-dimethoxy-2-methyl-5-[(E)-2-phenylprop-1-enyl]benzene |
| SMILES | COc1cc(/C=C(\C)c2ccccc2)c(OC)cc1C |
| InChI | InChI=1S/C18H20O2/c1-13(15-8-6-5-7-9-15)10-16-12-17(19-3)14(2)11-18(16)20-4/h5-12H,1-4H3/b13-10+ |
| InChIKey | SRMHUBPJNABAQV-JLHYYAGUSA-N |
| XLogP | 4.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|