C11H14NO4- — CID 163177021
N-[2-(2,5-dimethoxy-4-methylphenyl)ethenyl]-N-oxidohydroxylamine (PubChem CID 163177021) has the molecular formula C11H14NO4- and a molecular weight of 224.24 g/mol. Its IUPAC name is N-[2-(2,5-dimethoxy-4-methylphenyl)ethenyl]-N-oxidohydroxylamine.
| Compound Name | N-[2-(2,5-dimethoxy-4-methylphenyl)ethenyl]-N-oxidohydroxylamine |
|---|---|
| PubChem CID | 163177021 |
| Molecular Formula | C11H14NO4- |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | N-[2-(2,5-dimethoxy-4-methylphenyl)ethenyl]-N-oxidohydroxylamine |
| SMILES | COc1cc(C=CN([O-])O)c(OC)cc1C |
| InChI | InChI=1S/C11H14NO4/c1-8-6-11(16-3)9(4-5-12(13)14)7-10(8)15-2/h4-7,13H,1-3H3/q-1 |
| InChIKey | QJFWKZJYQMRYNO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|