C14H13ClFN3O2 — CID 107073648
1-[(3-chloro-2-fluorophenyl)methyl]-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide (PubChem CID 107073648) has the molecular formula C14H13ClFN3O2 and a molecular weight of 309.73 g/mol. Its IUPAC name is 1-[(3-chloro-2-fluorophenyl)methyl]-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide.
| Compound Name | 1-[(3-chloro-2-fluorophenyl)methyl]-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide |
|---|---|
| PubChem CID | 107073648 |
| Molecular Formula | C14H13ClFN3O2 |
| Molecular Weight | 309.73 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 1-[(3-chloro-2-fluorophenyl)methyl]-N'-hydroxy-6-methyl-2-oxopyridine-3-carboximidamide |
| SMILES | Cc1ccc(/C(N)=N/O)c(=O)n1Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C14H13ClFN3O2/c1-8-5-6-10(13(17)18-21)14(20)19(8)7-9-3-2-4-11(15)12(9)16/h2-6,21H,7H2,1H3,(H2,17,18) |
| InChIKey | LNWMRRQBDHMENX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 80.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.73 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|