C13H14BrFN4O — CID 107076351
3-bromo-5-fluoro-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)aniline (PubChem CID 107076351) has the molecular formula C13H14BrFN4O and a molecular weight of 341.18 g/mol. Its IUPAC name is 3-bromo-5-fluoro-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)aniline.
| Compound Name | 3-bromo-5-fluoro-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)aniline |
|---|---|
| PubChem CID | 107076351 |
| Molecular Formula | C13H14BrFN4O |
| Molecular Weight | 341.18 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 3-bromo-5-fluoro-2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)aniline |
| SMILES | Nc1cc(F)cc(Br)c1OCc1nnc2n1CCCC2 |
| InChI | InChI=1S/C13H14BrFN4O/c14-9-5-8(15)6-10(16)13(9)20-7-12-18-17-11-3-1-2-4-19(11)12/h5-6H,1-4,7,16H2 |
| InChIKey | LHNFYQHJKINIKS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.18 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|