C16H22N4O — CID 107076318
[3,5-dimethyl-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)phenyl]methanamine (PubChem CID 107076318) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is [3,5-dimethyl-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)phenyl]methanamine.
| Compound Name | [3,5-dimethyl-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 107076318 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | [3,5-dimethyl-4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethoxy)phenyl]methanamine |
| SMILES | Cc1cc(CN)cc(C)c1OCc1nnc2n1CCCC2 |
| InChI | InChI=1S/C16H22N4O/c1-11-7-13(9-17)8-12(2)16(11)21-10-15-19-18-14-5-3-4-6-20(14)15/h7-8H,3-6,9-10,17H2,1-2H3 |
| InChIKey | GRVKBYBRKQZDSS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |