5-(3,6-dichloropyridazin-4-yl)oxy-2-nitrobenzoic acid

C11H5Cl2N3O5 — CID 107077783

IUPAC5-(3,6-dichloropyridazin-4-yl)oxy-2-nitrobenzoic acid
SMILESO=C(O)c1cc(Oc2cc(Cl)nnc2Cl)ccc1[N+](=O)[O-]
InChIInChI=1S/C11H5Cl2N3O5/c12-9-4-8(10(13)15-14-9)21-5-1-2-7(16(19)20)6(3-5)11(17)18/h1-4H,(H,17,18)
InChIKeyAINOCGRSRSNPLM-UHFFFAOYSA-N
MW330.08 g/mol
LogP3.18
Rot. Bonds4

About 5-(3,6-dichloropyridazin-4-yl)oxy-2-nitrobenzoic acid

5-(3,6-dichloropyridazin-4-yl)oxy-2-nitrobenzoic acid (PubChem CID 107077783) has the molecular formula C11H5Cl2N3O5 and a molecular weight of 330.08 g/mol. Its IUPAC name is 5-(3,6-dichloropyridazin-4-yl)oxy-2-nitrobenzoic acid.

Molecular Properties

Compound Name5-(3,6-dichloropyridazin-4-yl)oxy-2-nitrobenzoic acid
PubChem CID107077783
Molecular FormulaC11H5Cl2N3O5
Molecular Weight330.08 g/mol
Exact Mass328.96
IUPAC Name5-(3,6-dichloropyridazin-4-yl)oxy-2-nitrobenzoic acid
SMILESO=C(O)c1cc(Oc2cc(Cl)nnc2Cl)ccc1[N+](=O)[O-]
InChIInChI=1S/C11H5Cl2N3O5/c12-9-4-8(10(13)15-14-9)21-5-1-2-7(16(19)20)6(3-5)11(17)18/h1-4H,(H,17,18)
InChIKeyAINOCGRSRSNPLM-UHFFFAOYSA-N
XLogP3.18
TPSA115.45 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.08
LogP ≤ 53.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 5-(3,6-dichloropyridazin-4-yl)oxy-2-nitrobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(3,6-dichloropyridazin-4-yl)oxy-2-nitrobenzoic acid?
The IUPAC name of 5-(3,6-dichloropyridazin-4-yl)oxy-2-nitrobenzoic acid (CID 107077783) is 5-(3,6-dichloropyridazin-4-yl)oxy-2-nitrobenzoic acid.
What is the SMILES notation for 5-(3,6-dichloropyridazin-4-yl)oxy-2-nitrobenzoic acid?
The canonical SMILES for 5-(3,6-dichloropyridazin-4-yl)oxy-2-nitrobenzoic acid is O=C(O)c1cc(Oc2cc(Cl)nnc2Cl)ccc1[N+](=O)[O-].
What is the InChIKey of 5-(3,6-dichloropyridazin-4-yl)oxy-2-nitrobenzoic acid?
The InChIKey is AINOCGRSRSNPLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5Cl2N3O5/c12-9-4-8(10(13)15-14-9)21-5-1-2-7(16(19)20)6(3-5)11(17)18/h1-4H,(H,17,18).
What are the key properties of 5-(3,6-dichloropyridazin-4-yl)oxy-2-nitrobenzoic acid?
5-(3,6-dichloropyridazin-4-yl)oxy-2-nitrobenzoic acid has a molecular weight of 330.08 g/mol, XLogP of 3.18, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,6-dichloropyridazin-4-yl)oxy-2-nitrobenzoic acid is sourced from PubChem (CID 107077783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).