10-methylanthracene-1,9-dicarboxylic acid

C17H12O4 — CID 10707846

IUPAC10-methylanthracene-1,9-dicarboxylic acid
SMILESCc1c2ccccc2c(C(=O)O)c2c(C(=O)O)cccc12
InChIInChI=1S/C17H12O4/c1-9-10-5-2-3-6-12(10)15(17(20)21)14-11(9)7-4-8-13(14)16(18)19/h2-8H,1H3,(H,18,19)(H,20,21)
InChIKeyQJSBHJHVSKZXNT-UHFFFAOYSA-N
MW280.28 g/mol
LogP3.70
Rot. Bonds2

About 10-methylanthracene-1,9-dicarboxylic acid

10-methylanthracene-1,9-dicarboxylic acid (PubChem CID 10707846) has the molecular formula C17H12O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 10-methylanthracene-1,9-dicarboxylic acid.

Molecular Properties

Compound Name10-methylanthracene-1,9-dicarboxylic acid
PubChem CID10707846
Molecular FormulaC17H12O4
Molecular Weight280.28 g/mol
Exact Mass280.07
IUPAC Name10-methylanthracene-1,9-dicarboxylic acid
SMILESCc1c2ccccc2c(C(=O)O)c2c(C(=O)O)cccc12
InChIInChI=1S/C17H12O4/c1-9-10-5-2-3-6-12(10)15(17(20)21)14-11(9)7-4-8-13(14)16(18)19/h2-8H,1H3,(H,18,19)(H,20,21)
InChIKeyQJSBHJHVSKZXNT-UHFFFAOYSA-N
XLogP3.70
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.28
LogP ≤ 53.70
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}

Analyze 10-methylanthracene-1,9-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 10-methylanthracene-1,9-dicarboxylic acid?
The IUPAC name of 10-methylanthracene-1,9-dicarboxylic acid (CID 10707846) is 10-methylanthracene-1,9-dicarboxylic acid.
What is the SMILES notation for 10-methylanthracene-1,9-dicarboxylic acid?
The canonical SMILES for 10-methylanthracene-1,9-dicarboxylic acid is Cc1c2ccccc2c(C(=O)O)c2c(C(=O)O)cccc12.
What is the InChIKey of 10-methylanthracene-1,9-dicarboxylic acid?
The InChIKey is QJSBHJHVSKZXNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O4/c1-9-10-5-2-3-6-12(10)15(17(20)21)14-11(9)7-4-8-13(14)16(18)19/h2-8H,1H3,(H,18,19)(H,20,21).
What are the key properties of 10-methylanthracene-1,9-dicarboxylic acid?
10-methylanthracene-1,9-dicarboxylic acid has a molecular weight of 280.28 g/mol, XLogP of 3.70, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methylanthracene-1,9-dicarboxylic acid is sourced from PubChem (CID 10707846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).