C13H14FN3O2S — CID 107078774
3-[(3-fluorophenyl)sulfonylmethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 107078774) has the molecular formula C13H14FN3O2S and a molecular weight of 295.34 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)sulfonylmethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[(3-fluorophenyl)sulfonylmethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 107078774 |
| Molecular Formula | C13H14FN3O2S |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 3-[(3-fluorophenyl)sulfonylmethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | O=S(=O)(Cc1nnc2n1CCCC2)c1cccc(F)c1 |
| InChI | InChI=1S/C13H14FN3O2S/c14-10-4-3-5-11(8-10)20(18,19)9-13-16-15-12-6-1-2-7-17(12)13/h3-5,8H,1-2,6-7,9H2 |
| InChIKey | LFXNMJYVQYTYGE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |