C17H22BrN3 — CID 107083396
4-(bromomethyl)-5-(2,2-dimethylpyrrolidin-1-yl)-3-methyl-1-phenylpyrazole (PubChem CID 107083396) has the molecular formula C17H22BrN3 and a molecular weight of 348.29 g/mol. Its IUPAC name is 4-(bromomethyl)-5-(2,2-dimethylpyrrolidin-1-yl)-3-methyl-1-phenylpyrazole.
| Compound Name | 4-(bromomethyl)-5-(2,2-dimethylpyrrolidin-1-yl)-3-methyl-1-phenylpyrazole |
|---|---|
| PubChem CID | 107083396 |
| Molecular Formula | C17H22BrN3 |
| Molecular Weight | 348.29 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 4-(bromomethyl)-5-(2,2-dimethylpyrrolidin-1-yl)-3-methyl-1-phenylpyrazole |
| SMILES | Cc1nn(-c2ccccc2)c(N2CCCC2(C)C)c1CBr |
| InChI | InChI=1S/C17H22BrN3/c1-13-15(12-18)16(20-11-7-10-17(20,2)3)21(19-13)14-8-5-4-6-9-14/h4-6,8-9H,7,10-12H2,1-3H3 |
| InChIKey | XLBQICKQJYYIHA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|