C20H26ClN3 — CID 142170476
1-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl]-4-methyl-4-prop-1-en-2-ylpiperidine (PubChem CID 142170476) has the molecular formula C20H26ClN3 and a molecular weight of 343.90 g/mol. Its IUPAC name is 1-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl]-4-methyl-4-prop-1-en-2-ylpiperidine.
| Compound Name | 1-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl]-4-methyl-4-prop-1-en-2-ylpiperidine |
|---|---|
| PubChem CID | 142170476 |
| Molecular Formula | C20H26ClN3 |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 1-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl]-4-methyl-4-prop-1-en-2-ylpiperidine |
| SMILES | C=C(C)C1(C)CCN(Cc2c(C)nn(-c3ccccc3)c2Cl)CC1 |
| InChI | InChI=1S/C20H26ClN3/c1-15(2)20(4)10-12-23(13-11-20)14-18-16(3)22-24(19(18)21)17-8-6-5-7-9-17/h5-9H,1,10-14H2,2-4H3 |
| InChIKey | AKMZDOIUXIFKSV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|