C15H13BrFNO3 — CID 107088286
2-[4-(bromomethyl)-2-fluorophenoxy]-1,5-dimethyl-3-nitrobenzene (PubChem CID 107088286) has the molecular formula C15H13BrFNO3 and a molecular weight of 354.18 g/mol. Its IUPAC name is 2-[4-(bromomethyl)-2-fluorophenoxy]-1,5-dimethyl-3-nitrobenzene.
| Compound Name | 2-[4-(bromomethyl)-2-fluorophenoxy]-1,5-dimethyl-3-nitrobenzene |
|---|---|
| PubChem CID | 107088286 |
| Molecular Formula | C15H13BrFNO3 |
| Molecular Weight | 354.18 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 2-[4-(bromomethyl)-2-fluorophenoxy]-1,5-dimethyl-3-nitrobenzene |
| SMILES | Cc1cc(C)c(Oc2ccc(CBr)cc2F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H13BrFNO3/c1-9-5-10(2)15(13(6-9)18(19)20)21-14-4-3-11(8-16)7-12(14)17/h3-7H,8H2,1-2H3 |
| InChIKey | YZNUYMYFHJEKDH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.18 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|