C15H14ClNO3 — CID 63566433
2-[4-(chloromethyl)phenoxy]-1,5-dimethyl-3-nitrobenzene (PubChem CID 63566433) has the molecular formula C15H14ClNO3 and a molecular weight of 291.73 g/mol. Its IUPAC name is 2-[4-(chloromethyl)phenoxy]-1,5-dimethyl-3-nitrobenzene.
| Compound Name | 2-[4-(chloromethyl)phenoxy]-1,5-dimethyl-3-nitrobenzene |
|---|---|
| PubChem CID | 63566433 |
| Molecular Formula | C15H14ClNO3 |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-[4-(chloromethyl)phenoxy]-1,5-dimethyl-3-nitrobenzene |
| SMILES | Cc1cc(C)c(Oc2ccc(CCl)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H14ClNO3/c1-10-7-11(2)15(14(8-10)17(18)19)20-13-5-3-12(9-16)4-6-13/h3-8H,9H2,1-2H3 |
| InChIKey | ZNQITVAWFFFMKU-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|