C15H11ClN2O3 — CID 62948840
2-chloro-4-(2,4-dimethyl-6-nitrophenoxy)benzonitrile (PubChem CID 62948840) has the molecular formula C15H11ClN2O3 and a molecular weight of 302.72 g/mol. Its IUPAC name is 2-chloro-4-(2,4-dimethyl-6-nitrophenoxy)benzonitrile.
| Compound Name | 2-chloro-4-(2,4-dimethyl-6-nitrophenoxy)benzonitrile |
|---|---|
| PubChem CID | 62948840 |
| Molecular Formula | C15H11ClN2O3 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-chloro-4-(2,4-dimethyl-6-nitrophenoxy)benzonitrile |
| SMILES | Cc1cc(C)c(Oc2ccc(C#N)c(Cl)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11ClN2O3/c1-9-5-10(2)15(14(6-9)18(19)20)21-12-4-3-11(8-17)13(16)7-12/h3-7H,1-2H3 |
| InChIKey | GSLFCPCJLSJWPW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|