C14H11N3O3 — CID 64593817
6-(2,4-dimethyl-6-nitrophenoxy)pyridine-2-carbonitrile (PubChem CID 64593817) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is 6-(2,4-dimethyl-6-nitrophenoxy)pyridine-2-carbonitrile.
| Compound Name | 6-(2,4-dimethyl-6-nitrophenoxy)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 64593817 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 6-(2,4-dimethyl-6-nitrophenoxy)pyridine-2-carbonitrile |
| SMILES | Cc1cc(C)c(Oc2cccc(C#N)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H11N3O3/c1-9-6-10(2)14(12(7-9)17(18)19)20-13-5-3-4-11(8-15)16-13/h3-7H,1-2H3 |
| InChIKey | UZBLADDAXLAODR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 89.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|