C12H11Br2N3O3 — CID 107089480
4-(bromomethyl)-5-(3-bromo-5-nitrophenoxy)-1,3-dimethylpyrazole (PubChem CID 107089480) has the molecular formula C12H11Br2N3O3 and a molecular weight of 405.05 g/mol. Its IUPAC name is 4-(bromomethyl)-5-(3-bromo-5-nitrophenoxy)-1,3-dimethylpyrazole.
| Compound Name | 4-(bromomethyl)-5-(3-bromo-5-nitrophenoxy)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 107089480 |
| Molecular Formula | C12H11Br2N3O3 |
| Molecular Weight | 405.05 g/mol |
| Exact Mass | 402.92 |
| IUPAC Name | 4-(bromomethyl)-5-(3-bromo-5-nitrophenoxy)-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(Oc2cc(Br)cc([N+](=O)[O-])c2)c1CBr |
| InChI | InChI=1S/C12H11Br2N3O3/c1-7-11(6-13)12(16(2)15-7)20-10-4-8(14)3-9(5-10)17(18)19/h3-5H,6H2,1-2H3 |
| InChIKey | CJGXCYDFSKULKV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.05 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|