C15H21ClN2O2S — CID 107091719
N-[[2-chloro-4-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methyl]ethanamine (PubChem CID 107091719) has the molecular formula C15H21ClN2O2S and a molecular weight of 328.87 g/mol. Its IUPAC name is N-[[2-chloro-4-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methyl]ethanamine.
| Compound Name | N-[[2-chloro-4-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 107091719 |
| Molecular Formula | C15H21ClN2O2S |
| Molecular Weight | 328.87 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-[[2-chloro-4-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(S(=O)(=O)N2CC=C(C)CC2)cc1Cl |
| InChI | InChI=1S/C15H21ClN2O2S/c1-3-17-11-13-4-5-14(10-15(13)16)21(19,20)18-8-6-12(2)7-9-18/h4-6,10,17H,3,7-9,11H2,1-2H3 |
| InChIKey | LSXFRDZEDGZJHH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.87 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|