C15H22N2O3S — CID 114414420
[2-ethoxy-5-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methanamine (PubChem CID 114414420) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is [2-ethoxy-5-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methanamine.
| Compound Name | [2-ethoxy-5-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methanamine |
|---|---|
| PubChem CID | 114414420 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | [2-ethoxy-5-[(4-methyl-3,6-dihydro-2H-pyridin-1-yl)sulfonyl]phenyl]methanamine |
| SMILES | CCOc1ccc(S(=O)(=O)N2CC=C(C)CC2)cc1CN |
| InChI | InChI=1S/C15H22N2O3S/c1-3-20-15-5-4-14(10-13(15)11-16)21(18,19)17-8-6-12(2)7-9-17/h4-6,10H,3,7-9,11,16H2,1-2H3 |
| InChIKey | AKPCJYWWWQUVNI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|