C14H24ClN3O — CID 107095589
3-[[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]methyl]cyclopentan-1-ol (PubChem CID 107095589) has the molecular formula C14H24ClN3O and a molecular weight of 285.82 g/mol. Its IUPAC name is 3-[[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]methyl]cyclopentan-1-ol.
| Compound Name | 3-[[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 107095589 |
| Molecular Formula | C14H24ClN3O |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 3-[[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]methyl]cyclopentan-1-ol |
| SMILES | CCCCc1nc(Cl)c(CNCC2CCC(O)C2)[nH]1 |
| InChI | InChI=1S/C14H24ClN3O/c1-2-3-4-13-17-12(14(15)18-13)9-16-8-10-5-6-11(19)7-10/h10-11,16,19H,2-9H2,1H3,(H,17,18) |
| InChIKey | LYJLTHPSOWSJKX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |