C14H24ClN3S — CID 107272042
1-(2-butyl-4-chloro-1H-imidazol-5-yl)-N-[(1-methylsulfanylcyclobutyl)methyl]methanamine (PubChem CID 107272042) has the molecular formula C14H24ClN3S and a molecular weight of 301.89 g/mol. Its IUPAC name is 1-(2-butyl-4-chloro-1H-imidazol-5-yl)-N-[(1-methylsulfanylcyclobutyl)methyl]methanamine.
| Compound Name | 1-(2-butyl-4-chloro-1H-imidazol-5-yl)-N-[(1-methylsulfanylcyclobutyl)methyl]methanamine |
|---|---|
| PubChem CID | 107272042 |
| Molecular Formula | C14H24ClN3S |
| Molecular Weight | 301.89 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-(2-butyl-4-chloro-1H-imidazol-5-yl)-N-[(1-methylsulfanylcyclobutyl)methyl]methanamine |
| SMILES | CCCCc1nc(Cl)c(CNCC2(SC)CCC2)[nH]1 |
| InChI | InChI=1S/C14H24ClN3S/c1-3-4-6-12-17-11(13(15)18-12)9-16-10-14(19-2)7-5-8-14/h16H,3-10H2,1-2H3,(H,17,18) |
| InChIKey | FOVVCBCJIGPDRE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.89 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |