C12H22ClN3O — CID 82719572
1-(2-butyl-4-chloro-1H-imidazol-5-yl)-N-[(2-methylpropan-2-yl)oxy]methanamine (PubChem CID 82719572) has the molecular formula C12H22ClN3O and a molecular weight of 259.78 g/mol. Its IUPAC name is 1-(2-butyl-4-chloro-1H-imidazol-5-yl)-N-[(2-methylpropan-2-yl)oxy]methanamine.
| Compound Name | 1-(2-butyl-4-chloro-1H-imidazol-5-yl)-N-[(2-methylpropan-2-yl)oxy]methanamine |
|---|---|
| PubChem CID | 82719572 |
| Molecular Formula | C12H22ClN3O |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 1-(2-butyl-4-chloro-1H-imidazol-5-yl)-N-[(2-methylpropan-2-yl)oxy]methanamine |
| SMILES | CCCCc1nc(Cl)c(CNOC(C)(C)C)[nH]1 |
| InChI | InChI=1S/C12H22ClN3O/c1-5-6-7-10-15-9(11(13)16-10)8-14-17-12(2,3)4/h14H,5-8H2,1-4H3,(H,15,16) |
| InChIKey | YLWDEVSZWKCYQI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|