C13H24ClN3O2 — CID 107095406
2-[3-[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]propoxy]ethanol (PubChem CID 107095406) has the molecular formula C13H24ClN3O2 and a molecular weight of 289.81 g/mol. Its IUPAC name is 2-[3-[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]propoxy]ethanol.
| Compound Name | 2-[3-[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]propoxy]ethanol |
|---|---|
| PubChem CID | 107095406 |
| Molecular Formula | C13H24ClN3O2 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-[3-[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]propoxy]ethanol |
| SMILES | CCCCc1nc(Cl)c(CNCCCOCCO)[nH]1 |
| InChI | InChI=1S/C13H24ClN3O2/c1-2-3-5-12-16-11(13(14)17-12)10-15-6-4-8-19-9-7-18/h15,18H,2-10H2,1H3,(H,16,17) |
| InChIKey | UUFGNAPQRGOTBG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|