C14H24ClN3O2 — CID 107272296
3-[[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]methyl]-2-methyloxolan-3-ol (PubChem CID 107272296) has the molecular formula C14H24ClN3O2 and a molecular weight of 301.82 g/mol. Its IUPAC name is 3-[[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]methyl]-2-methyloxolan-3-ol.
| Compound Name | 3-[[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]methyl]-2-methyloxolan-3-ol |
|---|---|
| PubChem CID | 107272296 |
| Molecular Formula | C14H24ClN3O2 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 3-[[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]methyl]-2-methyloxolan-3-ol |
| SMILES | CCCCc1nc(Cl)c(CNCC2(O)CCOC2C)[nH]1 |
| InChI | InChI=1S/C14H24ClN3O2/c1-3-4-5-12-17-11(13(15)18-12)8-16-9-14(19)6-7-20-10(14)2/h10,16,19H,3-9H2,1-2H3,(H,17,18) |
| InChIKey | JBLPVXBINWXSMY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |