C14H26ClN3O — CID 107095280
5-[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]-2-methylpentan-1-ol (PubChem CID 107095280) has the molecular formula C14H26ClN3O and a molecular weight of 287.83 g/mol. Its IUPAC name is 5-[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]-2-methylpentan-1-ol.
| Compound Name | 5-[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]-2-methylpentan-1-ol |
|---|---|
| PubChem CID | 107095280 |
| Molecular Formula | C14H26ClN3O |
| Molecular Weight | 287.83 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 5-[(2-butyl-4-chloro-1H-imidazol-5-yl)methylamino]-2-methylpentan-1-ol |
| SMILES | CCCCc1nc(Cl)c(CNCCCC(C)CO)[nH]1 |
| InChI | InChI=1S/C14H26ClN3O/c1-3-4-7-13-17-12(14(15)18-13)9-16-8-5-6-11(2)10-19/h11,16,19H,3-10H2,1-2H3,(H,17,18) |
| InChIKey | WXBUHQWKZIEUMY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.83 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|