C10H14ClN5S — CID 107649352
N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]thiadiazol-5-amine (PubChem CID 107649352) has the molecular formula C10H14ClN5S and a molecular weight of 271.78 g/mol. Its IUPAC name is N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]thiadiazol-5-amine.
| Compound Name | N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]thiadiazol-5-amine |
|---|---|
| PubChem CID | 107649352 |
| Molecular Formula | C10H14ClN5S |
| Molecular Weight | 271.78 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]thiadiazol-5-amine |
| SMILES | CCCCc1nc(Cl)c(CNc2cnns2)[nH]1 |
| InChI | InChI=1S/C10H14ClN5S/c1-2-3-4-8-14-7(10(11)15-8)5-12-9-6-13-16-17-9/h6,12H,2-5H2,1H3,(H,14,15) |
| InChIKey | LGYOQMXYQYDJLO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.78 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |