C14H15BrClF2N3 — CID 102852979
5-bromo-N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-2,4-difluoroaniline (PubChem CID 102852979) has the molecular formula C14H15BrClF2N3 and a molecular weight of 378.65 g/mol. Its IUPAC name is 5-bromo-N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-2,4-difluoroaniline.
| Compound Name | 5-bromo-N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 102852979 |
| Molecular Formula | C14H15BrClF2N3 |
| Molecular Weight | 378.65 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 5-bromo-N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-2,4-difluoroaniline |
| SMILES | CCCCc1nc(Cl)c(CNc2cc(Br)c(F)cc2F)[nH]1 |
| InChI | InChI=1S/C14H15BrClF2N3/c1-2-3-4-13-20-12(14(16)21-13)7-19-11-5-8(15)9(17)6-10(11)18/h5-6,19H,2-4,7H2,1H3,(H,20,21) |
| InChIKey | GJLXPUQLJJUCET-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.65 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|