C13H24ClN5 — CID 83010483
N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-4-methylpiperazin-1-amine (PubChem CID 83010483) has the molecular formula C13H24ClN5 and a molecular weight of 285.82 g/mol. Its IUPAC name is N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-4-methylpiperazin-1-amine.
| Compound Name | N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-4-methylpiperazin-1-amine |
|---|---|
| PubChem CID | 83010483 |
| Molecular Formula | C13H24ClN5 |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-4-methylpiperazin-1-amine |
| SMILES | CCCCc1nc(Cl)c(CNN2CCN(C)CC2)[nH]1 |
| InChI | InChI=1S/C13H24ClN5/c1-3-4-5-12-16-11(13(14)17-12)10-15-19-8-6-18(2)7-9-19/h15H,3-10H2,1-2H3,(H,16,17) |
| InChIKey | VWFOZXCYPCJGFR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 47.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |