C14H22ClN5 — CID 103005187
N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-2-(2-methylpyrazol-3-yl)ethanamine (PubChem CID 103005187) has the molecular formula C14H22ClN5 and a molecular weight of 295.82 g/mol. Its IUPAC name is N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-2-(2-methylpyrazol-3-yl)ethanamine.
| Compound Name | N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-2-(2-methylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 103005187 |
| Molecular Formula | C14H22ClN5 |
| Molecular Weight | 295.82 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-2-(2-methylpyrazol-3-yl)ethanamine |
| SMILES | CCCCc1nc(Cl)c(CNCCc2ccnn2C)[nH]1 |
| InChI | InChI=1S/C14H22ClN5/c1-3-4-5-13-18-12(14(15)19-13)10-16-8-6-11-7-9-17-20(11)2/h7,9,16H,3-6,8,10H2,1-2H3,(H,18,19) |
| InChIKey | MALBRXUCEZQEON-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|