C17H18Cl2 — CID 107099889
1-chloro-3-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2-methylbenzene (PubChem CID 107099889) has the molecular formula C17H18Cl2 and a molecular weight of 293.24 g/mol. Its IUPAC name is 1-chloro-3-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2-methylbenzene.
| Compound Name | 1-chloro-3-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2-methylbenzene |
|---|---|
| PubChem CID | 107099889 |
| Molecular Formula | C17H18Cl2 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 1-chloro-3-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2-methylbenzene |
| SMILES | Cc1ccc(CC(Cl)c2cccc(Cl)c2C)cc1C |
| InChI | InChI=1S/C17H18Cl2/c1-11-7-8-14(9-12(11)2)10-17(19)15-5-4-6-16(18)13(15)3/h4-9,17H,10H2,1-3H3 |
| InChIKey | UDOSOENDIJALGT-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|