C16H19ClS — CID 63432504
3-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2,5-dimethylthiophene (PubChem CID 63432504) has the molecular formula C16H19ClS and a molecular weight of 278.85 g/mol. Its IUPAC name is 3-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2,5-dimethylthiophene.
| Compound Name | 3-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2,5-dimethylthiophene |
|---|---|
| PubChem CID | 63432504 |
| Molecular Formula | C16H19ClS |
| Molecular Weight | 278.85 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 3-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2,5-dimethylthiophene |
| SMILES | Cc1cc(C(Cl)Cc2ccc(C)c(C)c2)c(C)s1 |
| InChI | InChI=1S/C16H19ClS/c1-10-5-6-14(7-11(10)2)9-16(17)15-8-12(3)18-13(15)4/h5-8,16H,9H2,1-4H3 |
| InChIKey | VIPNIMPPBJRBNO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.85 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|