C17H18ClI — CID 114029595
1-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2-iodo-3-methylbenzene (PubChem CID 114029595) has the molecular formula C17H18ClI and a molecular weight of 384.69 g/mol. Its IUPAC name is 1-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2-iodo-3-methylbenzene.
| Compound Name | 1-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2-iodo-3-methylbenzene |
|---|---|
| PubChem CID | 114029595 |
| Molecular Formula | C17H18ClI |
| Molecular Weight | 384.69 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 1-[1-chloro-2-(3,4-dimethylphenyl)ethyl]-2-iodo-3-methylbenzene |
| SMILES | Cc1ccc(CC(Cl)c2cccc(C)c2I)cc1C |
| InChI | InChI=1S/C17H18ClI/c1-11-7-8-14(9-13(11)3)10-16(18)15-6-4-5-12(2)17(15)19/h4-9,16H,10H2,1-3H3 |
| InChIKey | HUTJFBLBANRLIT-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.69 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|