C18H21N3O2 — CID 10710164
4-[[2-[[(2R)-3,3-dimethylbutan-2-yl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-methylbenzonitrile (PubChem CID 10710164) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 4-[[2-[[(2R)-3,3-dimethylbutan-2-yl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-methylbenzonitrile.
| Compound Name | 4-[[2-[[(2R)-3,3-dimethylbutan-2-yl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 10710164 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 4-[[2-[[(2R)-3,3-dimethylbutan-2-yl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-methylbenzonitrile |
| SMILES | Cc1cc(Nc2c(N[C@H](C)C(C)(C)C)c(=O)c2=O)ccc1C#N |
| InChI | InChI=1S/C18H21N3O2/c1-10-8-13(7-6-12(10)9-19)21-15-14(16(22)17(15)23)20-11(2)18(3,4)5/h6-8,11,20-21H,1-5H3/t11-/m1/s1 |
| InChIKey | HSEVGLOKLCKGHS-LLVKDONJSA-N |
| XLogP | 3.05 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|