C20H26O3 — CID 10710386
(4aR,10aR,11aR,11bR)-4,4,8,11b-tetramethyl-1,3,4a,5,6,10a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-2,9-dione (PubChem CID 10710386) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (4aR,10aR,11aR,11bR)-4,4,8,11b-tetramethyl-1,3,4a,5,6,10a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-2,9-dione.
| Compound Name | (4aR,10aR,11aR,11bR)-4,4,8,11b-tetramethyl-1,3,4a,5,6,10a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-2,9-dione |
|---|---|
| PubChem CID | 10710386 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (4aR,10aR,11aR,11bR)-4,4,8,11b-tetramethyl-1,3,4a,5,6,10a,11,11a-octahydronaphtho[2,1-f][1]benzofuran-2,9-dione |
| SMILES | CC1=C2C=C3CC[C@@H]4C(C)(C)CC(=O)C[C@@]4(C)[C@@H]3C[C@H]2OC1=O |
| InChI | InChI=1S/C20H26O3/c1-11-14-7-12-5-6-17-19(2,3)9-13(21)10-20(17,4)15(12)8-16(14)23-18(11)22/h7,15-17H,5-6,8-10H2,1-4H3/t15-,16-,17-,20+/m1/s1 |
| InChIKey | NHTGXLDCTQFPJN-VIPLHTEESA-N |
| XLogP | 3.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |