C19H26O4 — CID 163089835
2,3-dihydroxy-4,4,11b-trimethyl-2,3,4a,5,6,10a,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-9-one (PubChem CID 163089835) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 2,3-dihydroxy-4,4,11b-trimethyl-2,3,4a,5,6,10a,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-9-one.
| Compound Name | 2,3-dihydroxy-4,4,11b-trimethyl-2,3,4a,5,6,10a,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-9-one |
|---|---|
| PubChem CID | 163089835 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2,3-dihydroxy-4,4,11b-trimethyl-2,3,4a,5,6,10a,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-9-one |
| SMILES | CC1(C)C(O)C(O)CC2(C)C3CC4OC(=O)C=C4C=C3CCC12 |
| InChI | InChI=1S/C19H26O4/c1-18(2)15-5-4-10-6-11-7-16(21)23-14(11)8-12(10)19(15,3)9-13(20)17(18)22/h6-7,12-15,17,20,22H,4-5,8-9H2,1-3H3 |
| InChIKey | ZFNYIPCRCHUFBL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |