C22H34O5 — CID 162859498
[2-hydroxy-7-(2-hydroxyacetyl)-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-3-yl] acetate (PubChem CID 162859498) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is [2-hydroxy-7-(2-hydroxyacetyl)-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-3-yl] acetate.
| Compound Name | [2-hydroxy-7-(2-hydroxyacetyl)-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 162859498 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [2-hydroxy-7-(2-hydroxyacetyl)-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CC2(C)C3CCC(C)(C(=O)CO)C=C3CCC2C(C)(C)C1O |
| InChI | InChI=1S/C22H34O5/c1-13(24)27-16-11-22(5)15-8-9-21(4,18(25)12-23)10-14(15)6-7-17(22)20(2,3)19(16)26/h10,15-17,19,23,26H,6-9,11-12H2,1-5H3 |
| InChIKey | XJODMDZLXVNEOR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|