C22H36O5 — CID 162966693
[2-hydroxy-1-[6-hydroxy-8-(hydroxymethyl)-2,4b,8-trimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-yl]ethyl] acetate (PubChem CID 162966693) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is [2-hydroxy-1-[6-hydroxy-8-(hydroxymethyl)-2,4b,8-trimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-yl]ethyl] acetate.
| Compound Name | [2-hydroxy-1-[6-hydroxy-8-(hydroxymethyl)-2,4b,8-trimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-yl]ethyl] acetate |
|---|---|
| PubChem CID | 162966693 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | [2-hydroxy-1-[6-hydroxy-8-(hydroxymethyl)-2,4b,8-trimethyl-4,4a,5,6,7,8a,9,10-octahydro-3H-phenanthren-2-yl]ethyl] acetate |
| SMILES | CC(=O)OC(CO)C1(C)C=C2CCC3C(C)(CO)CC(O)CC3(C)C2CC1 |
| InChI | InChI=1S/C22H36O5/c1-14(25)27-19(12-23)20(2)8-7-17-15(9-20)5-6-18-21(3,13-24)10-16(26)11-22(17,18)4/h9,16-19,23-24,26H,5-8,10-13H2,1-4H3 |
| InChIKey | GZEJNAZZGALFJP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|