C12H20N2O2 — CID 107104037
3-(2-ethylhexyl)-1H-pyrimidine-2,4-dione (PubChem CID 107104037) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-(2-ethylhexyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 3-(2-ethylhexyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 107104037 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 3-(2-ethylhexyl)-1H-pyrimidine-2,4-dione |
| SMILES | CCCCC(CC)Cn1c(=O)cc[nH]c1=O |
| InChI | InChI=1S/C12H20N2O2/c1-3-5-6-10(4-2)9-14-11(15)7-8-13-12(14)16/h7-8,10H,3-6,9H2,1-2H3,(H,13,16) |
| InChIKey | PNVRSMDHVDDHAP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |