C7H9BrN2O3 — CID 107104127
5-bromo-3-(2-methoxyethyl)-1H-pyrimidine-2,4-dione (PubChem CID 107104127) has the molecular formula C7H9BrN2O3 and a molecular weight of 249.06 g/mol. Its IUPAC name is 5-bromo-3-(2-methoxyethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-bromo-3-(2-methoxyethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 107104127 |
| Molecular Formula | C7H9BrN2O3 |
| Molecular Weight | 249.06 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | 5-bromo-3-(2-methoxyethyl)-1H-pyrimidine-2,4-dione |
| SMILES | COCCn1c(=O)[nH]cc(Br)c1=O |
| InChI | InChI=1S/C7H9BrN2O3/c1-13-3-2-10-6(11)5(8)4-9-7(10)12/h4H,2-3H2,1H3,(H,9,12) |
| InChIKey | LVXMZYVOYJWBPT-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.06 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |