C12H9BrClN3O3 — CID 107104201
2-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-(2-chlorophenyl)acetamide (PubChem CID 107104201) has the molecular formula C12H9BrClN3O3 and a molecular weight of 358.58 g/mol. Its IUPAC name is 2-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-(2-chlorophenyl)acetamide.
| Compound Name | 2-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-(2-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 107104201 |
| Molecular Formula | C12H9BrClN3O3 |
| Molecular Weight | 358.58 g/mol |
| Exact Mass | 356.95 |
| IUPAC Name | 2-(5-bromo-2,4-dioxo-1H-pyrimidin-3-yl)-N-(2-chlorophenyl)acetamide |
| SMILES | O=C(Cn1c(=O)[nH]cc(Br)c1=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C12H9BrClN3O3/c13-7-5-15-12(20)17(11(7)19)6-10(18)16-9-4-2-1-3-8(9)14/h1-5H,6H2,(H,15,20)(H,16,18) |
| InChIKey | PYPIZBGNVACYNP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.58 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |