C12H10ClN3O3 — CID 103600179
N-(2-chlorophenyl)-2-(2,4-dioxo-1H-pyrimidin-3-yl)acetamide (PubChem CID 103600179) has the molecular formula C12H10ClN3O3 and a molecular weight of 279.68 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(2,4-dioxo-1H-pyrimidin-3-yl)acetamide.
| Compound Name | N-(2-chlorophenyl)-2-(2,4-dioxo-1H-pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 103600179 |
| Molecular Formula | C12H10ClN3O3 |
| Molecular Weight | 279.68 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | N-(2-chlorophenyl)-2-(2,4-dioxo-1H-pyrimidin-3-yl)acetamide |
| SMILES | O=C(Cn1c(=O)cc[nH]c1=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C12H10ClN3O3/c13-8-3-1-2-4-9(8)15-10(17)7-16-11(18)5-6-14-12(16)19/h1-6H,7H2,(H,14,19)(H,15,17) |
| InChIKey | SBRYOYOETYLUQN-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.68 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |