C16H17NO6 — CID 10710743
5-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 10710743) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is 5-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 10710743 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 5-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1ccc(C2=NOC(C3C(=O)OC(C)(C)OC3=O)C2)cc1 |
| InChI | InChI=1S/C16H17NO6/c1-16(2)21-14(18)13(15(19)22-16)12-8-11(17-23-12)9-4-6-10(20-3)7-5-9/h4-7,12-13H,8H2,1-3H3 |
| InChIKey | IYTUWUBIBJXCCU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|