C12H13NO2S — CID 10966475
(5R)-3-(4-methoxyphenyl)-5-[(2S)-thiiran-2-yl]-4,5-dihydro-1,2-oxazole (PubChem CID 10966475) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is (5R)-3-(4-methoxyphenyl)-5-[(2S)-thiiran-2-yl]-4,5-dihydro-1,2-oxazole.
| Compound Name | (5R)-3-(4-methoxyphenyl)-5-[(2S)-thiiran-2-yl]-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 10966475 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | (5R)-3-(4-methoxyphenyl)-5-[(2S)-thiiran-2-yl]-4,5-dihydro-1,2-oxazole |
| SMILES | COc1ccc(C2=NO[C@@H]([C@H]3CS3)C2)cc1 |
| InChI | InChI=1S/C12H13NO2S/c1-14-9-4-2-8(3-5-9)10-6-11(15-13-10)12-7-16-12/h2-5,11-12H,6-7H2,1H3/t11-,12-/m1/s1 |
| InChIKey | OIECLCCPLDUTRF-VXGBXAGGSA-N |
| XLogP | 2.30 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|