C16H16N2O2S — CID 107107788
2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-3-methylbenzenecarbothioamide (PubChem CID 107107788) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-3-methylbenzenecarbothioamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-3-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 107107788 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-ylamino)-3-methylbenzenecarbothioamide |
| SMILES | Cc1cccc(C(N)=S)c1Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H16N2O2S/c1-10-3-2-4-12(16(17)21)15(10)18-11-5-6-13-14(9-11)20-8-7-19-13/h2-6,9,18H,7-8H2,1H3,(H2,17,21) |
| InChIKey | CZCYTMBFAAJUHD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|