C13H12N4O2S — CID 80512123
3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)pyridazine-4-carbothioamide (PubChem CID 80512123) has the molecular formula C13H12N4O2S and a molecular weight of 288.33 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)pyridazine-4-carbothioamide.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 80512123 |
| Molecular Formula | C13H12N4O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylamino)pyridazine-4-carbothioamide |
| SMILES | NC(=S)c1ccnnc1Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H12N4O2S/c14-12(20)9-3-4-15-17-13(9)16-8-1-2-10-11(7-8)19-6-5-18-10/h1-4,7H,5-6H2,(H2,14,20)(H,16,17) |
| InChIKey | AXLRRQBSQHXWQW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|