C11H17F3N4S — CID 107109612
1-[1-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-yl]pyrazol-3-amine (PubChem CID 107109612) has the molecular formula C11H17F3N4S and a molecular weight of 294.35 g/mol. Its IUPAC name is 1-[1-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-yl]pyrazol-3-amine.
| Compound Name | 1-[1-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-yl]pyrazol-3-amine |
|---|---|
| PubChem CID | 107109612 |
| Molecular Formula | C11H17F3N4S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 1-[1-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-yl]pyrazol-3-amine |
| SMILES | Nc1ccn(C2CCN(CCSC(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C11H17F3N4S/c12-11(13,14)19-8-7-17-4-1-9(2-5-17)18-6-3-10(15)16-18/h3,6,9H,1-2,4-5,7-8H2,(H2,15,16) |
| InChIKey | ISHMQAQHZXUKHS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |