C8H13N3S — CID 84659250
1-(thian-4-yl)pyrazol-3-amine (PubChem CID 84659250) has the molecular formula C8H13N3S and a molecular weight of 183.28 g/mol. Its IUPAC name is 1-(thian-4-yl)pyrazol-3-amine.
| Compound Name | 1-(thian-4-yl)pyrazol-3-amine |
|---|---|
| PubChem CID | 84659250 |
| Molecular Formula | C8H13N3S |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 1-(thian-4-yl)pyrazol-3-amine |
| SMILES | Nc1ccn(C2CCSCC2)n1 |
| InChI | InChI=1S/C8H13N3S/c9-8-1-4-11(10-8)7-2-5-12-6-3-7/h1,4,7H,2-3,5-6H2,(H2,9,10) |
| InChIKey | LHGYKPZLUPKCKU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |