C9H13F2N3S — CID 97338491
1-(2,2-difluoroethyl)-N-[(3R)-thiolan-3-yl]pyrazol-3-amine (PubChem CID 97338491) has the molecular formula C9H13F2N3S and a molecular weight of 233.29 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-N-[(3R)-thiolan-3-yl]pyrazol-3-amine.
| Compound Name | 1-(2,2-difluoroethyl)-N-[(3R)-thiolan-3-yl]pyrazol-3-amine |
|---|---|
| PubChem CID | 97338491 |
| Molecular Formula | C9H13F2N3S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 1-(2,2-difluoroethyl)-N-[(3R)-thiolan-3-yl]pyrazol-3-amine |
| SMILES | FC(F)Cn1ccc(N[C@@H]2CCSC2)n1 |
| InChI | InChI=1S/C9H13F2N3S/c10-8(11)5-14-3-1-9(13-14)12-7-2-4-15-6-7/h1,3,7-8H,2,4-6H2,(H,12,13)/t7-/m1/s1 |
| InChIKey | VEMLEVXGOBKVJB-SSDOTTSWSA-N |
| XLogP | 2.07 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |