C12H21N3OS — CID 75380852
1-(3-methoxypropyl)-N-(thian-4-yl)pyrazol-3-amine (PubChem CID 75380852) has the molecular formula C12H21N3OS and a molecular weight of 255.39 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-N-(thian-4-yl)pyrazol-3-amine.
| Compound Name | 1-(3-methoxypropyl)-N-(thian-4-yl)pyrazol-3-amine |
|---|---|
| PubChem CID | 75380852 |
| Molecular Formula | C12H21N3OS |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 1-(3-methoxypropyl)-N-(thian-4-yl)pyrazol-3-amine |
| SMILES | COCCCn1ccc(NC2CCSCC2)n1 |
| InChI | InChI=1S/C12H21N3OS/c1-16-8-2-6-15-7-3-12(14-15)13-11-4-9-17-10-5-11/h3,7,11H,2,4-6,8-10H2,1H3,(H,13,14) |
| InChIKey | RIUQDTYRZRVVTQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|